The correct answer is the environment.
<span>Non-infectious diseases are those that are not contagious meaning that they can't be spread from one person to another (no vector for them to move). Non-infectious diseases are caused by factors, like genetics, environment, and behaviour. Some can be prevented, while others don’t. Examples of this type of diseases are autoimmune<span> diseases, cancers, allergies, sleep disorders, diabetes…</span></span>
Answer:
Small intestine, liver, bile and lipase.
Explanation:
Digestion of fat occurs in the small intestine. Its digestion occurs with the help of bile, that is made in the liver. Bile breaks the fat into small drops that are easier for the lipase enzymes to change it. Lipase enzymes is a type of enzymes that works only on lipids and lipids are broken down into fatty acids and glycerol. These substances are absorbed by our body and used it for producing ATP for the body.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Plants have a cell wall and chloroplasts; animal cells do not have either
Hope this helps : )
