Answer is: excess of hydrazine is 16 grams.
Chemical reaction: N₂O₄(l) + 2N₂H₄(l) → 3N₂(g) + 4H₂<span>O(g).
</span>m(N₂H₄) = 80,1 g.
m(N₂O₄) = 92,0 g.
n(N₂H₄) = m(N₂H₄) ÷ M(N₂H₄).
n(N₂H₄) = 80,1 g ÷ 32 g/mol.
n(N₂H₄) = 2,5 mol.
n(N₂O₄) = 92 g ÷ 92 g/mol.
n(N₂O₄) = 1 mol; limiting reactant.
From chemical reaction: n(N₂H₄) : n(N₂O₄) = 2 : 1.
n(N₂H₄) = 2 mol reacts.
Δn(N₂H₄) = 2,5 mol - 2 mol = 0,5 mol.
Δm(N₂H₄) = 0,5 mol · 32 g/mol = 16 g.
A compound that yields hydrogen ions when dissolved in a solution is an acid.
An example is an <em>aqueous solution of HCl.</em>
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Chemistry plays an important and useful role towards the development and growth of a number of industries. This includes industries like glass, cement, paper, textile, leather, dye etc. We also see huge applications of chemistry in industries like paints, pigments, petroleum, sugar, plastics, Pharmaceuticals.
