Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
This has all of the charges above the columns. Hopefully it helps!
Answer:
KBr dissolved in water.
Explanation:
A substance conducts electricity as a result of the presence of mobile ions in the substance.
An ionic substance such as KBr when dissolved in water releases free ions which become charge carriers in solution hence the solution conducts electricity. Solid ionic substances such as solid KBr and solid baking soda do not conduct electricity because the ions are strongly bound to each other in the crystal lattice.
Molecular substances such as sugar and alcohol do not conduct electricity even in solution.
Answer:
0.0445 M is the initial concentration of sulfurous acid.
Explanation:
To calculate the concentration of acid, we use the equation given by neutralization reaction:
where,
are the n-factor, molarity and volume of acid which is 
are the n-factor, molarity and volume of base which is NaOH.
We are given:
Putting values in above equation, we get:
0.0445 M is the initial concentration of sulfurous acid.
Answer:
B. the products have a smaller number of available energy microstates than the reactants.
