Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
1) This is a definition.
2) Protons are given by the bottom number (since atomic number = number of protons).
3) Neutrons = (mass number)-(atomic number), which are the top and bottom numbers, respectively.
4) Nuclear fusion involves combining two things together, which is only reflected by the last option.
5) This is a fact.
6) This is a fact.
7) This is a fact.
8) This is a fact.
9) The correct option is the explanation.
Answer:
This is the exact answer. Please give brainliest. The answer is 132.13952.
Explanation:
Answer: 51.9961 g/mol, don't know if it helps :)
Explanation:
That’s a hard one, but honestly i would go with a.
