Answer:
so you answer would be B
Explanation:
well what you would do is add 15+25=40 and what they are asking is whay are the degrees in the balloon so you would have B as your answer
hoped i helped have a great weekend
<span>a pure substance that can be separated into different elements by chemical means</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
I think it’s 1 mole
If Iam not mistaken
