False. It is a fluid as it is in its liquid state possessing qualities of a liquid just that it is viscious
The third substance or agent which produce the film between the interface of two immiscible liquids and thus stabilize the system are known as an emulsifying agent.
Since the solubility of the liquids depends on the polarity of the mixing liquids the thumb rule of solubility is like dissolves like that means polar liquid dissolves in polar liquid only and vice versa. For two immiscible liquids, the emulsifying agent is used which does not chemically change the polarity of liquids but acts as bridge between immiscible liquids, the polar end of the emulsifier attach to the polar liquid and the non-polar end of the emulsifier attach to the non-polar end and thus help in dissolving.
Therefore, the one end of the emulsifier is polar and the other end is non-polar
Hey there!
A half-life means after a certain amount of time, half of that substance will have decayed after that time.
An equation for exponential decay is the following:
y = a(1 - b)ⁿ
Where a is the original amount, b is the rate of decay, and n is time.
1000 is about 0.3 of a half life, 1000 divided by 138 days (3312 hours) is approximately 0.3.
Let's plug in values to that equation:
y = 321(1 - 0.5)^(0.3)
Simplify.
y = 260.73
There will be 260.73mg of polonium-210 remaining after 1000 hours.
Hope this helps!
Answer:
Answer: B. Water condenses to form clouds.
Explanation:
When the moisture condenses, this results in the release of energy. The energy causes the air to be warm and results in the rise of air in the upper atmosphere. This process results in the instability in the atmosphere and cumulonimbus clouds are formed. These clouds support lightening during a thunderstorm.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
