Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Using extension or flexible cords improperly
Explanation:
A client undergoing therapy in a whirlpool unit plugged into an extension cord demonstrates a wrong and improper use of extensions and flexible cords. This is not a safe way to connect an electrical circuit.
- Unless a Ground Fault Circuit Interrupter is used, the client is at a risk of suffering from electrocution.
- The Ground Fault Circuit Interrupter is able to detect leakages in the circuit and breaks it off.
learn more:
electric current brainly.com/question/4438943
#learnwithBrainly
b. increase in surface area
<h3>Further explanation</h3>
Given
Speeding up a chemical reaction
Required
Factors used to speed up reactions
Solution
There are several factors that influence reaction kinetics :
1. Concentration
2. Surface area
3. Temperature
4. Catalyst
5. Pressure
6. Stirring
Temperature is related to the kinetic energy of the particles. Heat is absorbed causes the particles of matter to move faster so that the reaction can take place faster
The enlarged surface area of the reactants causes more particles to react with other particles.
50 g square block of sulfur can be broken into small pieces or powdered so that more particles come into contact with each other
Weight varies dramatically if we leave earths surface.On the moon for example acceleration due to gravity is only 1.67m/s2 A 1.0-kg mass thus has a weight of 9.8 N on Earth and only about 1.7 N on the moon
