Answer:
If you mix equal amounts of a strong acid and a strong base, the two chemicals essentially cancel each other out and produce a salt and water. Mixing equal amounts of a strong acid with a strong base also produces a neutral pH (pH = 7) solution.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
The correct answer is "Secondary active transport".
Explanation:
Secondary active transport is a form of across the membrane transport that involves a transporter protein catalyzing the movement of an ion down its electrochemical gradient to allow the movement of another molecule or ion uphill to its concentration/electrochemical gradient. In this example, the transporter protein (antiporter), move 3 Na⁺ into the cell in exchange for one Ca⁺⁺ leaving the cell. The 3 Na⁺ are the ions moved down its electrochemical gradient and the one Ca⁺⁺ is the ion moved uphill its electrochemical gradient, because Na+ and Ca⁺⁺are more concentrated in the solution than inside the cell. Therefore, this scenario is an example of secondary active transport.
Answer:
0.05
moles
Explanation:
In a mole of any substance, there exist
6.02⋅1023
units of that substance.
So here, we got:
3.01⋅1022Mg atoms⋅1mol6.02⋅1023M gatoms=0.05mol
Answer:
Rotation: spins on its axis
Revolution: travels around another object
Explanation:
The Earth rotates on its axis, while it revolves around the sun.
The moon revolves around the Earth.
