1. alpha particle
alpha particles are positively charged helium nuclei with weak penetrating power
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Wikipedia
Blogs from random people
Answer:
The correct answer is: Dynamic equilibrium in a chemical reaction is the condition in which the rate of the forward reaction equals the rate of the reverse reaction.
Explanation:
Dynamic equilibrium is a chemical equilibrium between froward reaction and backward or reverse reaction where rate of reaction going forwards is equal to the rate of reaction going backward (reverse).
Some other properties of dynamic equilibrium are:
- Chemical equilibrium are attained is closed system.
- The macroscopic remains constant like: volume, pressure, energy etc.
- The concentration of the reactants and products remain constant.They are not always equal.
Answer:
c. liquid
Explanation:
because the are not very close if the said very closely packed together it would have been a solid
