Iron (iii) chloride is obtained by vapor condensation from the reaction between chlorine gas and iron fillings.
<h3>How can iron (iii) chloride be formed from iron fillings?</h3>
Iron (ii) chloride can be formed from iron fillings in the laboratory as follows:
- Iron fillings + Cl₂ → FeCl₃
Chlorine gas is introduced into a reaction vessel containing iron fillings and the iron (iii) chloride vapor formed is obtained by condensation.
In conclusion, iron (iii) chloride is formed by the the direct combination of iron fillings and chlorine gas.
Learn more about iron (iii) chloride at: brainly.com/question/14653649
#SPJ1
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
For this system, we use Dalton's law of partial pressures where the total pressure of a gas mixture is said to be equal to the sum of the partial pressures of the gases. The partial pressure of each gas would be calculated by the product of the mole fraction and the original pressure of the gas. We do as follows:
Total pressure = x1P1 + x2P2
Total pressure = (2.0 / 7.0 )(3.5) + (1.5/7.0)(2.6)
Total pressure = 1.56 atm
1 is D - double-replacements do not make solid metals
2 is A - to have complete combustion the original compound must ONLY have C, H and O
3 is B - the elemental Mg replaces the H in the HCl
