Answer:
0.21 g
Explanation:
The equation of the reaction is;
NaCl(aq) + AgNO3(aq) -----> NaNO3(aq) + AgCl(s)
Number of moles of NaCl= 0.0860 g /58.5 g/mol = 0.00147 moles
Number of moles of AgNO3 = 30/1000 L × 0.050 M = 0.0015 moles
Since the reaction is 1:1, NaCl is the limiting reactant.
1 mole of NaCl yields 1 mole of AgCl
0.00147 moles of NaCl yields 0.00147 moles of AgCl
Mass of precipitate formed = 0.00147 moles of AgCl × 143.32 g/mol
= 0.21 g
Answer:
6CO2 + 6H2O → C6H12O6 + 6O2 is a balanced equation
Explanation:
Carbon, Oxygen, Hydrogen
Reactants are carbon dioxide and water, products are glucose and oxygen
Dynamic Equilibrium I have no idea about (soz)
I believe this might be endothermic
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer: V2= 15.0403226 Liters
Explanation:
Use V1/T1=V2/T2
Make sure you change the degrees Celsius to Kelvin. (Kelvin = degrees Celsius +273)
10.0L / 248 K = V2/ 373 K
Cross multiply V1 and T2 and divide by T1
(10.0 L)( 373K)/ 248 K = V2
V2= 15.0403226 Liters (Kelvin cancels out)
Answer:
C Fossil fuels will run out soon