Answer: The answer would be D.
Explanation: When a screw is tightened into an object, it is wedge in between.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Simply put, density is how tightly “stuff” is packed into a defined space.
For example, a suitcase jam-packed with clothes and souvenirs has a high density, while the same suitcase containing two pairs of underwear has low density. Size-wise, both suitcases look the same, but their density depends on the relationship between their mass and volume.
Mass is the amount of matter in an object.
Volume is the amount of space that an object takes up in three dimensions.
Density is calculated using the following equation: Density = mass/volume or D = m/v.
If something is heavy for its size, it has a high density. If an object is light for its size it has a low density.
The relative densities of an object and the liquid it is placed in determine whether that object will sink or float.
<span>Fungal diseases are difficult to treat mainly because they are eukaryotic organisms just like us humans, and therefore have less differences for drugs to target without harming the human body as well. Most antibiotics target e.g. the peptidoglycan layer in the bacterial (a prokaryote) cell wall, which is a safe target since eukaryotic cells do not have equivalent structures. Similarly many differences in metabolic pathways between humans and prokaryotes is often targeted by antibiotics, but metabolism of fungi and humans is much more uniform, and hence it is difficult to exclusively target the fungi only.
HOPE THIS HELPS!
</span>
