The change that would need to be made to the slit spacing in order to see a diffraction pattern is bending, because in understanding why light behaves like a wave, it is the interference and diffraction were the phenomena distinguish waves from particles but waves are the only one can interfere and diffract while particles do not. The light bends around obstacles or cylinder like waves do, then it is bending which cause and resulted in the single slit diffraction pattern.
Answer:
atomic number
Explanation:
isotope is a family of an element with the same atomic number but different mass number.
Answer:
C. If a solar cell breaks, it releases chemicals and can harm humans.
Explanation:
Hope this helped! :)
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
I've prepared some analysis and <span>cucumbers do have many comparable properties to potatoes, tomatoes, and lemons, all of which I know do work. So I would presume that cucumbers would also work. I would recommend trying it yourself to perceive. I'd love to hear the outcomes of your experiment. ;) </span>
