Answer:
1. A circuit is a path that electricity flows along. It starts at a power source, like a battery, and flows through a wire to a light bulb or other object and back to other side of the power source.
2. A series circuit is one that has more than one resistor, but only one path through which the electricity (electrons) flows. All the components in a series circuit are connected end-to-end. A resistor in a circuit is anything that uses some of the power from the cell.
3. A parallel circuit is a circuit in which the electric current passes through two or more branches or connected parts at the same time before it combines again. Compare.
4. BOTH - 1. lightbulb 2. battery 3. switch
SERIES- 1. Ammeter 2. voltmeter
i'm not sure about the rest sorry :(
The green and black symbols refer to atoms, that make up the molecule of water, more specifically you can say that the 2 Hydrogen atoms are the black ones found outside, while the central atom, that is also green would be oxygen.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
<span>First - you need the empirical formula.
So, assume you have 100 g of the compound.
If so, you'll have 54.53 gram of C, 9.15 g of H and 36.32 g of O. Find the number of moles of each.
54.53 g C (1 mole C / 12.01 g C) = 4.540
9.15 g H (1 mole H / 1.008 g H) = 9.077
36.32 g O (1 mole O / 15.9994 g O) = 2.270
Take the smallest number found and divide the others by it to get the empirical formula.
4.540/2.270 = 2.
9.077/2.270 = 4.
2.270/2.270 =1.
So, that gives you the empirical formula of C2H4O.
Find the weight of this compound. C = 12, H = 1, O = 16. So, C2H4O is 44 amu.
132/44 = 3.
So, 3 (C2 H4 O) = C6H12O3 = molecular formula.</span>
Answer:
I am going to chose your apple on your breakfast plate. Somebody plantes the apple seed. The apple tree takes time to grow. Once the apples are ready to be picked they are picked. Then the apples are sorted and go off to different schools like your school. Which is where you pick the apple up and put it on your plate.
Explanation:
