Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer: dry ice is a solid which makes it different from a gas
Explanation:
Answer:
stable isotopes have stable nuclei and do not show radioactivity, but for unstable isotopes it is the opposite
Explanation:
hope this helps, ask more questions if needed.
Answer:
Beta rays are electrons.
Explanation:
A neutron in the nucleus of a radioactive atom decays into a proton and an electron, which is emitted from the atom.
the number of protons and the number of neutrons determine an element's mass number. :D
