In early ninetees it was used as a paint in watch factories.
The roles of hydrogen peroxide, oxygen, hydrogen, and catalase in the following chemical reaction <span>the roles of hydrogen peroxide, oxygen, hydrogen, and catalase in the following chemical reaction.</span>
The right answer is noble gases.
The noble gases, or rare gases, are the chemical elements of group 18 (formerly "group VIIIA" or even "group 0") of the periodic table. These are helium He, neon 10Ne, argon 18Ar, krypton 36Kr, xenon 54Xe and radon 86Rn, the latter being radioactive.
This property means that they can not bind with other atoms to form molecules or lose electrons to transform into ions, hence their name noble or inert gases (they are not very active and do not do not mix). In nature, all elements "want" to become stable.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Answer:
3 atoms of O
8.57g
Explanation:
The problem here is to find the mass of oxygen in the compound and the number of atoms of oxygen.
The formula of the compound is:
NaHCO₃;
Here we have:
1 atom of Na
1 atom of H
1 atom of C
3 atoms of O
So there are 3 atoms of O
To find the mass of oxygen , we use the molar mass of oxygen;
Molar mass of oxygen = 16g/mol
Mass of oxygen = 
x 15 = 8.57g
