Answer:
Electronegativity is a measure of an atom's ability to attract shared electrons to itself. On the periodic table, electronegativity generally increases as you move from left to right across a period and decreases as you move down a group.
Explanation:
Hope it is helpful....
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
independent variable- instrumental music
dependent variable- Number of stacks of papers made
experimental variable- Group A has instrumental music
playing
constant- same task,
Explanation:
Plant cells, along with every other cell, needs oxygen,carbon, and nitrogen. These are basically the elements every living cell needs to survive.
Plant cells also need sunlight for photosynthesis and produce sugar to convert that into food. <span />
<span>a group of atoms responsible for the characteristic reactions of a particular compound.</span>
