Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
The valence of lead is 4.
Hence the name of the compound is called Lead (IV) oxide.
<h3>Further explanation</h3>
Given
PbO₂ compound
Required
The valence of Pb
Solution
The oxidation number of element O in the compound = -2, except for OF₂ the oxidation state = + 2 and the peroxides (Na₂O₂, BaO₂) the oxidation state = -1 and superoxide, for example KO₂ = -1/2.
The oxidation state in the uncharged compound = 0,
So The oxidation state of Pb :
Pb + 2.(-2) = 0
Pb - 4 = 0
Pb = +4
Answer:
Two object must have different temperatures
Explanation:
Heat Transfer can occur in 3 ways: Conduction, Convection, and Radiation
The concentration of ca 2 in blood plasma in equivalent if its concentration is 0.0080.
Concentration means the amount of or parts in terms of the alternative components. For acid–base reactions, the equivalent weight of an acid or base is the mass which materials or reacts with one mole of hydrogen
In chemistry, equal weight (additionally known as gram equal is the mass of 1 equivalent, that is the mass of a given substance as a way to integrate with or displace a fixed amount of any other substance. The equivalent weight of an detail is the mass which combines with or displaces 1.008 gram of hydrogen or eight. Zero grams of oxygen or 35.five grams of chlorine. those values correspond to the atomic weight divided through the usual valence for oxygen as example that is sixteen.
Charge on one Ca 2+ ion = + 2 .
Concentration of calcium ion = 0.0040M
⇒ Concentration of Ca 2 + in blood plasma = 0.0040 × 2
= 0.0080 equivalent Ca 2 answer
Learn more about concentration here :- brainly.com/question/14469428
#SPJ4
None. To bind with an hydrogem atom, the carbon needs to ''share'' one of it's valence electron's with the hydrogen's valence electron. Therefore, forming 4 bounds means the carbon atom will share it's 4 valence electrons and there will be no lone electrons.
Read more on Brainly.com -
brainly.com/question/1075300#readmore
