It is an example of a physical change because the chocolate changes from a solid to a liquid however it’s chemical composition is not changed so it’s a physical change.
Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
Explanation:
From the question we are told that:
Mass of mixture
Mass of Barium
Equation of Reaction is given as
Generally the equation for Moles of Barium is mathematically given by
Since
Therefore
Generally the equation for Mass of Barium is mathematically given by
Therefore
Answer:- There are particles in the container present at 23 degree C and 101.3 pKa.
Solution:- The given volume of the container is 4.0 L at 23 degree C and 101.3 kPa pressure.
We would calculate the moles using ideal gas law equation(PV = nRT) and then the moles are converted to particles on multiply the moles by Avogadro number.
Let's convert degree C to kelvin and pKa to atm.
T = 23 + 273 = 296 K
P = 101.3 pKa = 1 atm
R =
V = 4.0 L
n = ?
Let's plug in the values in the equation:
1(4.0) = n(0.0821)(296)
4.0 = n(24.3)
n = 0.165 mol
Let's multiply the moles by Avogadro number to get the number of particles:
= particles
So, from above calculations there would be particles in the container.