Location = nucleus ,
and you can see the total charge on the number that written below the substance, which would be 28+
hope this helps
Answer: Hmmmmm that's crazy....
There are a couple of equations one could use for this type of problem, but I find the following to be the easiest to use and to understand.
Fraction remaining (FR) = 0.5n
n = number of half lives that have elapsed
In this problem, we need to find n and are given the FR, which is 1.56% or 0.0156 (as a fraction).
0.0156 = 0.5n
log 0.0156 = n log 0.5
-1.81 = -0.301 n
n = 6.0 half lives have elapsed
Explanation:
Just wanted to help. Hopefully it's correct wouldn't want to waster your time ;)
Is there any answer choices before i get started on working out the problem
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
<span>H2. Since the difference in electronegativity between two identical atoms is 0, the resulting molecule is non-polar.</span>
