It should be potential energy!!!
Answer:
T2 = 550K
Explanation:
From Charles law;
V1/T1 = V2/T2
Where;
V1 is initial volume
V2 is final volume
T1 is initial temperature
T2 is final temperature
We are given;
V1 = 20 mL
V2 = 55 mL
T1 = 200 K
Thus from V1/T1 = V2/T2, making T2 the subject;
T2 = (V2 × T1)/V1
T2 = (55 × 200)/20
T2 = 550K
The volume of a substance is simply the ratio of mass and
density. Therefore:
volume = mass / density
Calculating for volume of Carbon Tetrachloride that the
student has to pour out:
volume = 55.0 g / (1.59 g / cm^3)
<span>volume = 34.60 cm^3</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
