The answer is B because <span>It would be useful to memorize that sentence. Once you know that, you can figure out whatever else happens at the anode, the cathode, in the solution, and in the external circuit.</span>
Answer:
Metals lose electrons to become cations.
Explanation:
For example, sodium loses an electron to become a sodium cation.
Na· ⟶ Na⁺ + e⁻
A is <em>wrong</em>. Nonmetals gain electrons to become anions.
B is <em>wrong</em>. Metals lose electrons.
D is <em>wrong</em>. Nonmetals gain electrons to become anions.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane