Answer: 7.025959200000001
Explanation:
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The properties of substances can be used to put the into groups.
<h3>Grouping of substances</h3>
In chemistry, it is often necessary to put substances into groups based on similarity in their properties. This is what led to the idea of a periodic table of elements.
Similarly, when we have unknown substances, we can group them according to the similarities in their properties.
Learn more about properties of substances: brainly.com/question/19886211
