1) H2O is able to dissolve both polar molecules and non polar ones
2) due to its extreme polarity it can even dissolve some I onic compounds
3 the h2o molecule itself is small in size
Polar liquids have both negative and positive ends.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
A.has mass and takes up space
Answer:
yes
Explanation:
sodium is salt and you can get it in the store or anywere.
