The filament holds up the anther so that pollination and fertilization can occur!
Chloride ions Cl –(aq) (from the dissolved sodium chloride) are discharged at the positive electrode as chlorine gas, Cl 2(g) sodium ions Na +(aq) (from the dissolved sodium chloride) and hydroxide ions OH –(aq) (from the water) stay behind - they form sodium hydroxide solution, NaOH(aq)
Hey there :)
We can see that the solubility of salt increases with increasing temperature. This happens with most substances.
To find out the maximum mass of copper sulfate that can be dissolved in water at these temperatures, just interpret the graph.
Considering Y-axis as g copper sulfate/100 g water and the X-axis as the temperature in °C:-
<u>1)</u>
a: <u>0 °C - 14 g of copper sulfate/100 g of water</u>
b: <u>50 °C - 34 g of copper sulfate/100 g of water</u>
c: <u>90 °C - 66 g of copper sulfate/100 g of </u><u>water</u>
<u>2)</u> From the graph, we can infer that temperature affects the solubility of the salt.
<em>Answered</em><em> </em><em>by</em><em> </em><em>Benjemin360</em><em> </em>:)
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
drought
Explanation:
droughts are long periods without water