To know the density you also need to know the volume of the rock.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Since both atoms are the same and are both nonmetals, they would form a Nonpolar covalent bond. This bond occurs when usually atoms of the same element or atoms of propriety electronegativity differences are sharing electrons to form bonds. There is an equal sharing of valence electrons in this chemical bond.
D.) a transformation of light energy into chemical energy