Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:You would weigh less on the moon because there is less gravity on the moon.
Explanation:
Answer:
B) is reduced.
Explanation:
Oxidation:
Oxidation involve the removal of electrons and oxidation state of atom of an element is increased.
Reduction:
Reduction involve the gain of electron and oxidation number is decreased.
Consider the following reactions.
4KI + 2CuCl₂ → 2CuI + I₂ + 4KCl
the oxidation state of copper is changed from +2 to +1 so copper get reduced and it is oxidizing agent.
CO + H₂O → CO₂ + H₂
the oxidation state of carbon is +2 on reactant side and on product side it becomes +4 so carbon get oxidized and it is reducing gent.
Oxidizing agents:
Oxidizing agents oxidize the other elements and itself gets reduced.
Reducing agents:
Reducing agents reduced the other element are it self gets oxidized.
Volume is 60 and the area is 94 have a great day
