Answer:
When the two atoms move towards each other a compound is formed by sharing electron pairs supplied by each of the atoms to enable them have the stable 8 (octet) valency electrons in their outermost shell
Explanation:
The electronic configuration of the given element can be written as follows;
1s²2s²2p⁴
The given electronic configuration is equivalent to that of oxygen, therefore, we have;
The number of electrons in the valence shell = 2 + 4 = 6 electrons
Therefore, each atom requires 2 electrons to complete its 8 (octet) electrons in the outermost shell
When the two atoms move towards each other, they react and combine to form a compound by sharing 4 electrons, 2 from each atom, such that each atom can have an extra 2 electrons in its outermost orbit in the newly formed compound and the stable octet configuration is attained by each of the atoms in the newly formed compound.
Answer:
Al(NO3)3(s)--------> Al^3+(aq) + 3NO3^-(aq)
Explanation:
The equation shown above describes the dissolution of Al(NO3)3 in water using the lowest coefficients.
This occurs when solid Al(NO3)3 is added to water. It dissolves to give rise to ions as shown. This is a property of all ionic substances.
Answer:
eheheehehehszndn!jejxxnndrrjrrrfufurururufjththjrjrjdjjjrj\u\ujrjeejrjjjj carbon
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
