All categories

3 years ago

Which type of cell junctions allow cellular communication?

Chemistry

1 answer:

Otrada [13]3 years ago

6 0

Answer:

Explanation:

Communicating junctions or gap juctions consider direct substance correspondence between contiguous cell cytoplasm through dispersion without contact with the extracellular liquid.

You might be interested in

If I had 3.50 x 10 24molecules of Cl2 gas, how many grams is this?

Zinaida [17]

Answer:

412 g Cl₂

General Formulas and Concepts:

Atomic Structure

Reading a Periodic Table
Moles
Avogadro's Number - 6.022 × 10²³ atoms, molecules, formula units, etc.

Stoichiometry

Using Dimensional Analysis

Explanation:

Step 1: Define

[Given] 3.50 × 10²⁴ molecules Cl₂

[Solve] grams Cl₂

Step 2: Identify Conversions

Avogadro's Number

[PT] Molar Mass of Cl - 35.45 g/mol

Molar Mass of Cl₂ - 2(35.45) = 70.9 g/mol

Step 3: Convert

[DA] Set up: $\displaystyle 3.50 \cdot 10^{24} \ molecules \ Cl_2(\frac{1 \ mol \ Cl_2}{6.022 \cdot 10^{23} \ molecules \ Cl_2})(\frac{70.9 \ g \ Cl_2}{1 \ mol \ Cl_2})$
[DA] Divide/Multiply [Cancel out units]: $\displaystyle 412.072 \ g \ Cl_2$

Step 4: Check

Follow sig fig rules and round. We are given 3 sig figs.

412.072 g Cl₂ ≈ 412 g Cl₂

5 0

3 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

3 years ago

Oxygen gas, generated by the reaction 2KClO3(s)---2KCl(s)+3O2(g), is collected over water at 27•C in 3.72L vassel at a total pre

Julli [10]

Answer:

moles = 0.093 moles

Explanation:

In this case, we know that this reaction is taking plave in a vessel that has a 730 torr of total pressure.

The total pressure is a value obtained by:

Pt = Pwater + PO2

We need to know the pressure of O2, because then, with stoichiometry, we can calculate the moles of KClO3

The pressure of oxygen is:

PO2 = 730 - 26 = 704 Torr

Now, this pressure is in Torr, and we need to convert it to Atm, so:

704 Torr / 760 Torr = 0.9263 atm

Now, let's use the ideal gas equation:

PV = nRT

With this expression, we will calculate the moles of O2, and then, the moles of KClO3:

n = PV/RT

R = 0.082 L atm /K mol

P = 0.9263 atm

V = 3.72 L

T = 27 + 273 = 300 K

Replacing the data:

n = 0.9263 * 3.72 / 300 * 0.082

n = 0.14 moles

Finally, by stoichiometry, we know that 2 moles of KClO3 produces 3 moles of O2, so:

moles of KClO3 = 0.14 * 2/3 = 0.093 moles of KClO3

6 0

3 years ago

A scientist stores a very large number of particles in a container. In order to determine the number of particles, the scientist

Leni [432]

When the temperature and the volume of the gas stored in the container are high then the number of the moles will be measured accurately. Thus, options A and B are correct.

<h3>What is the ideal gas law?</h3>

The ideal gas law is the establishment of the relation between the elements like the moles, pressure, temperature, and the volume of the gas containing the particle.

The ideal gas states:

PV = nRT

With an increase in the temperature, the number of particles that collides increases as the kinetic energy increases. The particle of the container is more when the volume of the gas is more.

Therefore, in options A and B high temperature and volume increase the accuracy.

Learn more about ideal gas here:

brainly.com/question/14552813

#SPJ1

6 0

2 years ago

8. What type of reaction is this:

arsen [322]

Answer:

The reaction mentioned in the question is a decomposition reaction.

Explanation:

Decomposition reaction is a specific type of chemical reaction in which the reactant molecule undergo break down to generate its respective products.

NaCl ⇒ Na + Cl2

In the above reaction sodium chloride(NaCl) undergo decomposition or break down to generate Sodium(Na) and chlorine gas(Cl2).

3 0

4 years ago

Read 2 more answers