A) Nitrogen has an ATOMIC mass number of 14, but nitrogen gas consists of N₂ molecules, so the mass to use in this problem is 28 g/mol. Rates of effusion ∝ 1/√(mass), so
<span>√(mass unknown) /√28 = (rate N₂ effusion)/(rate unknown effusion) = 1.59 </span>
<span>∴ mass unknown = (1.59)²(28) = 70.78 g/mol </span>
<span>B) One possible gas that comes close for this mass is NF₃.</span>
Answer:
0.125
Explanation:
im not sure but if you get the grams then divide by the sufficance of xy
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
The protons in an nucleus of an atom will not change unless a nuclear reaction takes place. The number of protons is equal to the atomic number of the element. For a neutral atom, the number of electrons and protons are equal. When they are unequal, then the atom occurs as an ion. It will has a net charge with it. The ion O²⁻ has a net charge of negative positive 2 because it has 2 more electrons than its protons. Since neutral oxygen has 8 protons, then O²⁻ ion has 8 protons and 10 electrons.
