Answer:
I attached a photo of balanced equations but thats as much as I can help.
Explanation:
Answer: 2.8 moles
Explanation:
The balanced equation below shows that 1 mole of sodium oxide reacts with 1 mole of water to form 2 moles of sodium hydroxide respectively.
Na2O + H2O --> 2NaOH
1 mole of H2O = 2 moles of NaOH
Let Z moles of H2O = 5.6 mole of NaOH
To get the value of Z, cross multiply
5.6 moles x 1 mole= Z x 2 moles
5.6 = 2Z
Divide both sides by 2
5.6/2 = 2Z/2
2.8 = Z
Thus, 2.8moles of H2O are needed to produce 5.6 mol of NaOH
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
a. 0.137
b. 0.0274
c. 1.5892 g
d. 0.1781
e. 5.6992 g
<h3>Further explanation</h3>
Given
Reaction
2 C4H10 + 13O2 -------> 8CO2 + 10H2O
2.46 g of water
Required
moles and mass
Solution
a. moles of water :
2.46 g : 18 g/mol = 0.137
b. moles of butane :
= 2/10 x mol water
= 2/10 x 0.137
= 0.0274
c. mass of butane :
= 0.0274 x 58 g/mol
= 1.5892 g
d. moles of oxygen :
= 13/2 x mol butane
= 13/2 x 0.0274
= 0.1781
e. mass of oxygen :
= 0.1781 x 32 g/mol
= 5.6992 g
