Answer:
Molecule that contains at least one unpaired electron is called a radical.
The concept to be used in order to determine the diameter of the second cell in the photograph is that of the ratio and proportion. The ratio of the first set of measurements should be proportional (equal) to the ratio of the second set.
Ratio of first set of diameters,
r = diameter of Cell A / diameter of Cell B
r = 12 micrometers/20 micrometers
r = 3/5
If we let D be the diameter of the cell B in photographs,
r = 3/5 = 15 cm/x cm
The value of x from the equation is 25. Hence, the diameter of cell B is 25 cm.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
From ideal gas equation that is pv =nRt
n=number of moles which can be written as the ratio between the weight of a gas that is mass and its molecular mass n=m/Mm
pv=(m/Mm)RT
density is=mass per unit volume
P=m/v by arranging the equation we get
R =0.082atm/mol/k
Mm=pRT/P=[(1.10 x10^-6 x1000g/l) xo.082 atm/mol/k x(80+273] /(1.00 x10^-3) =31.84 to the nearest ten is 32
hence the gas is oxygen