Answer:
The atomic mass of Zinc is 65.30 Da
Explanation:
<u>Step 1: </u>Data given
3 major isotopes
⇒ Zinc-64
atomic mass = 63.929 Da
Peak intensity = 100
⇒ Zinc-66
atomic mass = 65.9260 Da
Peak intensity = 57.4
⇒ Zinc- 68
atomic mass = 67.9248 Da
Peak intensity = 38.6
<u />
<u>Step 2:</u> Calculate the natural abundance
∑peak intensity = 100 + 57.4 + 38.6 = 196
Zinc-64 : 100/196 = 0.5102 ⇒ 51.02 %
Zinc-66 : 57.4/196 = 0.2929 ⇒ 29.29 %
Zinc-68 : 38.6/196 = 0.1969 ⇒ 19.69 %
<u>Step 3:</u> Calculate the atomic mass if Zinc
63.9291 * 0.5102 + 65.9260*0.2929 + 67.9248*0.1969 = 65.3007 Da
The atomic mass of Zinc is 65.30 Da
The answer would be both, because the physical change is liquid to gases, and the chemical change is the molecules being split into hydrogen and oxygen molecules.
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Glass is formed when sand or rocks are heated to high temperatures and then cooled rapidly to create glass. i learned that from minecraf,t when u put sand in a furnace lol
Answer:
3 significant zeroes
Explanation:
To count the number of significant figures, you must pass the zeroes until you reach a non-zero value. Once you reach it, count anything after that as significant values, including the non-zero value itself.
The number has 4 significant figures with 3 significant zeroes.
Hope this helps!!!