Yes. Racist it will make it harder to move almost like ooblek
Answer:
Explanation:
Electrons are transferred from atoms of sodium to atoms of phosophorus. This transfer makes the sodium atoms positive and the phosphorus atoms negative. As a result, the sodium and phosphorus atoms strongly attract each other.
If you mean what group of elements react the most, the answer is the alkali metals and the halogens because they both only either need to gain or lose one electron. If you mean the most reactive element, it would be fluorine because it has the most electronegativity.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Acid Rain is formed when chemicals in the air get into rain and up the acidity levels!!!!!!
Hope this helps guys!
