The series of reactions is:
4 NH3 + 5 O2 → 4 NO + 6 H2O <span>
6 NO + P4 → P4O6 + 3 N2
P4O6 + 6 H2O → 4 H3PO3
4 H3PO3 → PH3 + 3 H3PO4 </span>
<span>
We multiply the first equation by a number 3 and all the
other equations by number 2, so that we get:
12 NH3 + 15 O2 → 12 NO + 18 H2O
12 NO + 2 P4 → 2 P4O6 + 6 N2
2 P4O6 + 12 H2O → 8 H3PO3
8 H3PO3 → 2 PH3 + 6 H3PO4
Then the overall reaction is:
12 NH3 + ... → 2 PH3 + ...
</span>
<span>So calculating for PH3:
<span>(1.10 g NH3) / (17.0306 g NH3/mol) x (2/12) x (33.9976 g
PH3/mol) = 0.366 g PH3</span></span>
First you need to balance the equation. Ba(OH)2+2HNO3=Ba(NO3)2+H2O. Then you can get the ratio of mole number of the reactants. The ratio is Ba(OH)2:HNO3=1:2. So the molarity of Ba(OH)2 is 38.5*0.85/2/20=0.82 molar.
Every single person in any scientific field that uses chemistry
ANSER TO #11 Large convection currents in the aesthenosphere transfer heat to the surface, where plumes of less dense magma break apart the plates at the spreading centers, creating divergent plate boundaries.
As the plates move away from the spreading centers, they cool, and the higher density basalt rocks that make up ocean crust get consumed at the ocean trenches/subduction zones. The crust is recycled back into the aesthenosphere.Heat generated from the radioactive decay of elements deep in the interior of the Earth creates magma (molten rock) in the aesthenosphere.
The aesthenosphere (70 ~ 250 km) is part of the mantle, the middle sphere of the Earth that extends to 2900 km. It contrasts with the more rigid lithosphere, the outer shell of the Earth (0 ~ 70 km) that contains the continental crust (made up of less dense granitic rocks) and the oceanic crust (more dense basaltic rocks) that are broken up into more than a dozen rigid plates.
Source: http://www.ucmp.berkeley.edu/education/dynamic/session1/sess1_earthcurrents.html
Answer:
19
Explanation:
1240.64/64
This is a simple division that can easily be evaluated using any form of calculator.
Here, the main challenge is in expressing the answer in the proper number of significant figure.
The approach here is to express the answer to the which is least precise. This is usually the number with the lower significant values.
Here, 64 has two significant figures and it is of a lower rank. Our answer should be expressed this way:
= 19.385 = 19