Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Phase changes typically occur when the temperature or pressure of a system is altered. When temperature or pressure increases, molecules interact more with each other. When pressure increases or temperature decreases, it's easier for atoms and molecules to settle into a more rigid structure.
Explanation:
Hope it helps UvU
B) convection
Explanation:
Once the sun's energy reaches the earth's atmosphere by radiation, it is circulated within the atmosphere and oceans through convection.
The energy of the sun on earth is moved between the ocean and the atmosphere by air around us.
- Heat transfer in fluids is by convection.
- It involves the actual motion of the particles of medium from one place to another due to differences in temperature and density.
- Air close to the surface of the ocean is less dense and hot due to high temperature.
- The air rises and it is replaced by colder air masses.
- This exchange leads to the development of convective cells.
- This moves the energy of the sun between the atmosphere and the ocean surface.
learn more:
Radiation brainly.com/question/1140127
#learnwithBrainly
Answer:
carbon atoms tend to make four bonds, each carbon atom will have the number of hydrogen atoms that are required for four bonds. This compound contains 16 hydrogen atoms for a molecular formula of C 8 H 16.
Explanation:
Answer:
16,,24Mg 17,,a24.1 18a mass number of the most abundant isotope
Explanation:
atomic number of Mg is 12 ,therefore its mass number should be the value that is very close to 24.
24.1 is the value of thee most abundant isotope.
