Answer:
we only see parts of the lit side as the moon goes around the earth
Explanation:
Unlike the sun, the moon orbits the Earth. This is the reason why we see the <em>different phases of the moon.</em> The reflection of the moon is being illuminated back to us with the help of the sun. So, as the moon circles the Earth, we only see parts of the lit side. Such changes helps us see the moon in different phases such as<em> </em>the <em>Third Quarter, Crescent, New Moon, Full Moon, etc.</em>
For example, during "Full Moon," <em>the moon's entire face is lit up by the sun</em>. Thus, we see the entire moon's lit portion.
Thus, this explains the answer.
ΔG° at 450. K is -198.86kJ/mol
The following is the relationship between ΔG°, ΔH, and ΔS°:
ΔH-T ΔS = ΔG
where ΔG represents the common Gibbs free energy.
the enthalpy change, ΔH
The temperature in kelvin is T.
Entropy change is ΔS.
ΔG° = -206 kJ/mol
ΔH° equals -220 kJ/mol
T = 298 K
Using the formula, we obtain:
-220kJ/mol -T ΔS° = -206kJ/mol
220 kJ/mol +206 kJ/mol =T ΔS°.
-T ΔS = 14 kJ/mol
for ΔS-14/298
ΔS=0.047 kJ/mol.K
450K for the temperature Completing a formula with values
ΔG° = (450K)(-0.047kJ/mol)-220kJ/mol
ΔG° = -220 kJ/mol + 21.14 kJ/mol.
ΔG°=198.86 kJ/mol
Learn more about ΔG° here:
brainly.com/question/17214066
#SPJ4
Answer:
The element is strontium and the number of neutrons it have is 51.
Explanation:
Based on the given information, the ionic compound is,
XCl₂ ⇔ X₂⁺ + 2Cl⁻
X2+ is the ion of the mentioned element
As mentioned in the given question, the number of electrons of the element X is 36 and as seen from the reaction the charge present on the ion is +2. Now the atomic number will be,
No. of electrons = atomic number - charge
36 = atomic number - 2
Atomic number = 38
Based on the periodic table, the atomic number 38 is for strontium element, and the sign of strontium is Sr. Hence, the element X is Sr.
Now based on the given information, the mass number of the element is 89. Now the no. of neutrons will be,
No. of neutrons = mass number - atomic number
= 89 - 38
= 51 neutrons.
Answer:
A. Chemistry can help a chef understand how to combine different ingredients in a recipe.
Explanation:
Knowing the chemical reactions between ingredients used in cooking helps chefs understand how well different ingredients would react to eachother.
*Im pretty sure this is correct.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
