The stoichiometric ratio of CuCl2 to NaCl is 1 is to 2. The stoichiometric ratio of 31.0 g CuCl2 is 26.95 grams of NaCl by converting the amount of CuCl2 to mole and multiplying by 0.5 and molar mass of NaCl.This amount is equal to 78.65% yield.
A student builds a model of a race car. The scale is 1:15. In the scale model, the car is 8 cm tall. How tall is the actual car?
<h2>Answers:</h2>
<h3>A. 120 cm</h3>
#CarryOnLearning
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Mols CuSO4 = M x L = 1.50 x 0.150 = 0.225
<span>mols KOH = 3.00 x 0.150 = 0.450 </span>
<span>specific heat solns = specific heat H2O = 4.18 J/K*C </span>
<span>CuSO4 + 2KOH = Cu(OH)2 + 2H2O </span>
<span>q = mass solutions x specific heat solns x (Tfinal-Tinitial) + Ccal*deltat T </span>
<span>q = 300g x 4.18 x (31.3-25.2) + 24.2*(31.3-25.2) </span>
<span>dHrxn in J/mol= q/0.225 mol CuSO4 </span>
<span>Then convert to kJ/mol
</span>
The net cell reaction is: 2Al(s) + 2Br2(l) → 4Br(s) + 2Al2O3(s)
What is a net cell reaction?
A net cell reaction is the overall chemical reaction that occurs during a redox reaction in a cell. It is the sum of all of the individual chemical reactions that take place in the cell and is usually written as an equation with the reactants on the left-hand side and the products on the right-hand side.
What is a chemical reaction?
A chemical reaction is a process in which two or more substances interact to form new substances with different chemical properties. Chemical reactions involve the breaking and forming of chemical bonds, releasing or absorbing energy, and can be either exothermic (releasing energy) or endothermic (absorbing energy).
To know more about chemical reactions,
brainly.com/question/16416932
#SPJ4
