There are 6.022 × 10²³ atoms in 39.948 g of argon and 4.0026 g of helium.
Explanation:
39.945 g/mole is the molar mass of argon so 39.948 g of argon are equal to 1 mole of argon.
4.0026 g/mole is the molar mass of helium so 4.0026 g of helium are equal to 1 mole of helium.
We know that Avogadro's number tell us the number of particles in 1 mole of substance which is 6.022 × 10²³.
So in 39.948 g of argon and 4.0026 g of helium contains the same number of atoms, 6.022 × 10²³.
Learn more about:
Avogadro's number
brainly.com/question/14148121
brainly.com/question/1445383
brainly.com/question/1528951
#learnwithBrainly
Answer:
sorry
Explanation:
I don't know the answer this is really confusing but I am really sorry you have to do this.
Explanation:
The given cell reaction is as follows.
Hence, reactions taking place at the cathode and anode are as follows.
At anode ; Oxidation-half reaction : 
...... (1)
At cathode; Reduction-half reaction : 
....... (2)
Hence, balance the half reactions by multiplying equation (1) by 2 and equation (2) by 3.
Therefore, net cell reaction is as follows.
Net reaction: 
Thus, we can conclude that the overall cell reaction is as follows.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
