A compound is a substance that consists of 2 or more elements chemically combined in a fixed proportion.
Compounds can be broken down ijt0 simple substances by chemical means but, elements cannot.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
D.The transferring of thermal energy from the sun to the earth!
Answer:
Pure water is a non conductor of electricity and dilute acids in their aqueous solutions form free ions, which conducts electricity. Thus when we need to electrolyse water, a dilute acid is added to increase its conductivity.
answer: the variable part of an amino acid is the: SIDE CHAIN