It introduces a diverse array of bacteria, algae, and invertebrates to the closed marine environment and functions as a superior biological filter
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Explanation:
In a chemical reaction, the atoms and molecules produced by the reaction are called products.
In a chemical reaction, only the atoms present in the reactants can end up in the products. No new atoms are created, and no atoms are destroyed.
In a chemical reaction, reactants contact each other, bonds between atoms in the reactants are broken, and atoms rearrange and form new bonds to make the products.
The particle that adds mass but no charge to the atomic nucleus is the neutron.
The nucleus contains both protons and neutrons.
Protons and neutrons have about the same mass.
However, protons have a positive charge, while <em>neutrons have no charge</em>,
