4 years ago

What are the characteristics of a mixture?

1 answer:

4 0

Properties of mixtures:
1. Parts of a mixture are physically combines.
2. Parts of mixtures keep their own properties.
3.Can be mixed together in different amounts.
4. Can be physically separated.

You might be interested in

Select the correct answer.

GREYUIT [131]

Answer:HNO3 + NaOH → H2O + NaNO3

Explanation:

8 0

4 years ago

A sodium ion has a positive charge because it has

Assoli18 [71]

Because it has more protons than electrons. Protons are positive so if there is more of them than electrons, the ion will have a positive charge.

7 0

3 years ago

Is this statement true or false? A change in temperature is always an indicator of a chemical reaction.

Naily [24]

Answer:

Explanation:

Absolutely true

5 0

3 years ago

Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type

Dmitry [639]

Precipitation reaction and double displacement reaction

7 0

3 years ago

In a saturated fatty acid, every carbon atom is saturated with __________.

marta [7]

Carbon atoms are saturated with (surrounded by) Hydrogen atoms

8 0

3 years ago