Answer:
Consumers must consume other organisms to get the food that they need and are known as Heterotrophs as they cannot make their own glucose. These consumers eat producers (plants). Herbivores are considered as first order consumers. These consumers eat consumers and producers (animals and plants).
If the moon did not rotate we would see all hemispheres of the moon as it revolves around the Earth and not just the phases.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer: i don't know
Explanation:
u gave no information on what you're asking
Answer:
Explanation:
6CO₂ + 6 H₂O ⇄ C₆H₁₂0₆ + 6O₂
This is the chemical equation given .
1. The equation shows a __Chemical equation_______the breaking and forming of chemical bonds that leads to a change in the composition of matter.
2. In the equation, CO₂ is a___reactant_____.
3. In the equation, C₆H₁₂0₆ is a ___product________.
4. In O₂, the type of bond that holds the two oxygen atoms together is a_nonpolar_covalent bond_________.
5. In H₂O, the type of bond that holds one of the hydrogen atoms to the oxygen atom is a__polar_hydrogen bond____.
6. The number of oxygen atoms on the left side of the equation is__equal to_________ the number of oxygen atoms on the right side.
