Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
The proton and neutron are so similar in mass that both of their relative masses = 1.
In Fructose, there are 4 carbon atoms. Fructose is a 5 atom molecule, and one of these is oxygen, therefore, the other 4 are carbon.
In Galactose, there are 6 carbon atoms.
Hope this helps :)
Nonrenewable natural resources are resources that cannot be replenished within a lifetime.
Answer:
False: <span>The major component in a solution is called the Solvent.
Explanation:
Solutions are the Homogeneous mixtures of two or more substances. Mainly the components are divided into two catogories....
1) Solvent:
The component which is the major or which is present in large amount is called solvent.
Example: In water salt solution water is the solvent.
2) Solute:
</span>The component which is the minor or which is present in less amount is called solute.
Example: In water salt solution salt is the solute.
