2 years ago

Explain how the integumentary system plays a crucial role in the ability to maintain homeoestasis

1 answer:

6 0

The integumentary system has multiple roles in homeostasis, including protection, temperature regulation, sensory reception, biochemical synthesis, and absorption. All body systems work in an interconnected manner to maintain the internal conditions essential to the function of the body.

You might be interested in

Helpppppp!!!!! It’s due today <br> URGENT!!!!!

VladimirAG [237]

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

5 0

3 years ago

Which atom has the weakest attraction for electrons in a chemical bond? A) a boron atom B) a calcium atom C) a fluorine atom D)

Black_prince [1.1K]

<span> The answer is
B) a calcium atom</span>

3 0

3 years ago

5. A family is traveling using three different modes of transportation. Seven of them travel in a large recreational vehicle, tw

telo118 [61]

Answer:

All three vehicles have the same kinetic energy because they have equal speed.

7 0

3 years ago

Which answer below correctly identifies the type of change and the explanation when magnesium comes into contact with hydrochlor

Oliga [24]

Answer:

A chemical change because a temperature change occurred, the solid disappeared and a gas was produces

Explanation:

Magnesium reacts with hydrochloric acid releasing energy, and leading to the formation of magnesium chloride and hydrogen gas. This is represented by the equation below:

Mg₍s₎ + 2HCl₍aq)⇒ MgCl₂₍aq₎ + H₂₍g₎

5 0

3 years ago

Read 2 more answers

What items could scientists use to date a layer of rock

Charra [1.4K]

By Using relative and radiometric dating methods hope this helps!!

4 0

3 years ago