CBr4 is a symmetric tetrahedral molecule so it will be non-polar.
The carnivores are the hawk, owl, and fox.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
ICMP Echo Request
Explanation:
ICMP Echo Request is a form of probe or message sent by a user to a destination system.
It required a fixed finite amount these zones are known as energy levels
