The answer is state.
That is the state would be least helpful in determining whether a substance is a metal or a nonmetal. The state can only tells that a compound is liquid, gas or solid. But it can't tell whether a substance is metal or non-metal. So it is the least helpful in determining whether a compound is metal or non-metal.
Answer:
I think in the middle of the day because the sun isn't going down yet
Explanation:
It is practical research of Boyle’s law..
PLS MARK BRAINLIEST
I need one more to rank up!!
Answer:
Your cation is Pb2+
Explanation:
This is the explanation by chemical reactions
HCl (l) ----> H+(aq) + Cl-(aq)
Pb2+(aq) + 2Cl-(aq) ---> PbCl2 (s) ↓
H2SO4 (l) ----> 2H+ (aq) + SO4-2(aq)
Pb2+(aq) + SO4-2(aq) ---> PbSO4 (s) ↓
NaOH (l) ---> Na+(aq) + OH-(aq)
Pb2+(aq) + 2OH-(aq) ---> Pb(OH)2 (s) ↓
If the reaction takes place in a strong alkaline medium, lead hydroxide dissolves in excess of base
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
