Answer:
is cool is cool goodcripopo
Answer:
A. m C5H12 = 108.23 g
B. m F2 = 547.142 g
C. m Ca(CN)2 = 71.85 g
Explanation:
- mass (m) = mol (n) × molecular weigth (Mw)
∴ Mw C5H12 = ((12.011)(5)) + ((1.008)(12)) = 72.151 g/mol C5H12
∴ Mw F2 = (18.998)(2) = 37.996 g/mol F2
∴ Mw = Ca(CN)2 = 40.078+((12.011+14.007)(2)) = 92.114 g/mol Ca(CN)2
A. m C5H12 = ( 1.50 mol)×(72.151 g/mol) = 108.23 g C5H12
B. m F2 = (14.4 mol)×(37.996 g/mol) = 547.142 g F2
C. m Ca(CN)2 = (0.780 mol)×(92.114 g/mol) = 71.85 g Ca(CN)2
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
It would be compound.
Explanation:
It is this way because if it adds another proton it becomes more positive that nuetral, and if you add an electron it just makes the atom more dense. That is why the answer is compound. Hope this helped :)
