I cant answer that if I cant see it
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
1) d
2) b because the independent variable is the thing you change/control in an experiment
3) c because the dependent variable is the thing being measured in an experiment
4)hmm it might be d, as c and a are both correct as different sized feeders would make it an unfair test and different types of food would as well
5) c
6) a
7) b obviously because if he activated them at different times then the ones activated last would have an advantage
1- can cause insecurities and make people less confident
2- Words can reflect on someone’s mood throughout the day
3- might cause depression or anxiety
4- listening to negative words constantly can make the person’s mind think it’s the truth
5- might change a person
