What is au electron configuration

Helpppppp!!!!! It’s due today <br> URGENT!!!!!

VladimirAG [237]

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

5 0

3 years ago

How does the abundance of various isotopes affect the atomic mass?

eduard

solution:

The quoted atomic mass on the Periodic Table is the WEIGHTED average of the individual isotopic masses. The higher the isotopic percentage, the MORE that isotope will contribute to the isotopic mass. For this reason, most masses that are quoted on the Table are non-integral.

By way of example we could look to the hydrogen atom. The VAST majority of hydrogen atoms (in this universe) are the protium isotope. i.e. 1H, whose nuclei contain JUST the defining proton. There is a smaller percentage (>1%) of hydrogen atoms WITH one NEUTRON in their nuclei to give the deuterium isotope. i.e. 2H, and because this is relatively cheap, and easily incorporated into a molecule, deuterium labelling is routinely used in analysis.

And there is even a smaller percentage of hydrogen atoms with TWO NEUTRONS in their nuclei, to give the tritium isotope. i.e. 3H. The weighted average of the isotopic percentages gives $1.00794⋅g⋅mol^{−1}$

6 0

3 years ago

Which statement correctly compares ice and liquid water?

Evgen [1.6K]

Answer:

B. Particles of liquid water have more energy than particles of ice.

Explanation:

We can work this out through eliminating the wrong statements.

A. Both liquid water and ice have definite shapes.

This is wrong because, as stated in the question, water is a liquid, and one of the properties of liquids is that they change shape to fit the shape of their container. If it changes shape, it does not have a "definite" shape.

B. Particles of liquid water have more energy than particles of ice.

This is correct, and here is why. There are 3 states of matter: solid, liquid and gas. As you apply heat energy to an object at each state, the particles receive more energy and can move around more (this is kinetic energy). In the case of liquid (water) and solid (ice), particles in solids do not have much energy and stay in rigid formations. They do vibrate slightly, but only on the spot (this is what gives solids "definite" shapes). On the other hand, particles in liquids have more energy than particles in solids, which means that they can move more (more kinetic ENERGY) and do not stay in formations (this is why they do not have "definite" shapes). Therefore, particles in liquids (water) have more energy than particles in solids (ice), and this statement is correct.

C. Liquid water has a lower temperature than ice.

This is wrong because liquids have more energy than solids. As explained earlier, the reason why particles in liquids have more energy is because more HEAT energy has been applied to them. In the same way, solids have less energy because less HEAT energy has been applied to them. Less heat means a lower temperature. (Also you can use common sense for this one, ice feels colder than liquid water, right?)

D. Ice has a definite volume, but liquid water does not.

This is wrong because of the law of conservation of mass. This law states that particles (or matter or volume) cannot be created or destroyed. When ice melts and becomes liquid water, it has not lost volume: the particles have just gained more energy. This question is most likely there to confuse you, because all substances have definite volumes.

I hope this helps!

5 0

3 years ago

why do solids keep their shape and volume why do liquids keep only volume and why do gases not keep either shape or volume

kodGreya [7K]

Solids always have definite shape and definite volume because their particles are packed together. Liquids have a definite volume but not definite shape, because their particles still kinda tight but able to move around, and gases don’t have a definite shape nor volume, because their particles are crazy and go everywhere

6 0

3 years ago

Write a nuclear equation for the alpha decay of 23892U.23892U → 0−1e + 23893Np23892U → 10n + 23792U23892U → 42He + 23490Th23892U

romanna [79]

Answer:

23892U=23490Th +42He

Explanation:

In alpha decay, the daughter nucleus is two units less than the parent in atomic number. The mass number also decreases by 4 units. The daughter is thus found two places before the parent in the periodic table.

5 0

3 years ago